C23H26BrN7O2 — CID 3098999
2-N-[(3-bromo-4-methoxyphenyl)methylideneamino]-4-N-(2,5-dimethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 3098999) has the molecular formula C23H26BrN7O2 and a molecular weight of 512.41 g/mol. Its IUPAC name is 2-N-[(3-bromo-4-methoxyphenyl)methylideneamino]-4-N-(2,5-dimethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(3-bromo-4-methoxyphenyl)methylideneamino]-4-N-(2,5-dimethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3098999 |
| Molecular Formula | C23H26BrN7O2 |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 2-N-[(3-bromo-4-methoxyphenyl)methylideneamino]-4-N-(2,5-dimethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(C=NNc2nc(Nc3cc(C)ccc3C)nc(N3CCOCC3)n2)cc1Br |
| InChI | InChI=1S/C23H26BrN7O2/c1-15-4-5-16(2)19(12-15)26-21-27-22(29-23(28-21)31-8-10-33-11-9-31)30-25-14-17-6-7-20(32-3)18(24)13-17/h4-7,12-14H,8-11H2,1-3H3,(H2,26,27,28,29,30) |
| InChIKey | IZWWLHXXRMAQLX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|