C18H23IN6O2 — CID 1131976
N-(4-iodo-2-methylphenyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 1131976) has the molecular formula C18H23IN6O2 and a molecular weight of 482.33 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(4-iodo-2-methylphenyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1131976 |
| Molecular Formula | C18H23IN6O2 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Cc1cc(I)ccc1Nc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H23IN6O2/c1-13-12-14(19)2-3-15(13)20-16-21-17(24-4-8-26-9-5-24)23-18(22-16)25-6-10-27-11-7-25/h2-3,12H,4-11H2,1H3,(H,20,21,22,23) |
| InChIKey | IOOVSBMBVKWSOG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|