C21H25N7O2 — CID 118467402
N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2-methylquinolin-8-amine (PubChem CID 118467402) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2-methylquinolin-8-amine.
| Compound Name | N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2-methylquinolin-8-amine |
|---|---|
| PubChem CID | 118467402 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2-methylquinolin-8-amine |
| SMILES | Cc1ccc2cccc(Nc3nc(N4CCOCC4)nc(N4CCOCC4)n3)c2n1 |
| InChI | InChI=1S/C21H25N7O2/c1-15-5-6-16-3-2-4-17(18(16)22-15)23-19-24-20(27-7-11-29-12-8-27)26-21(25-19)28-9-13-30-14-10-28/h2-6H,7-14H2,1H3,(H,23,24,25,26) |
| InChIKey | USNKMZHENLVIEP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |