C24H27ClN6O2 — CID 141427246
2-N-(5-amino-2-cyclopropylphenyl)-5-chloro-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 141427246) has the molecular formula C24H27ClN6O2 and a molecular weight of 466.97 g/mol. Its IUPAC name is 2-N-(5-amino-2-cyclopropylphenyl)-5-chloro-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(5-amino-2-cyclopropylphenyl)-5-chloro-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141427246 |
| Molecular Formula | C24H27ClN6O2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-N-(5-amino-2-cyclopropylphenyl)-5-chloro-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(N2CCOCC2)ccc1Nc1nc(Nc2cc(N)ccc2C2CC2)ncc1Cl |
| InChI | InChI=1S/C24H27ClN6O2/c1-32-22-13-17(31-8-10-33-11-9-31)5-7-20(22)28-23-19(25)14-27-24(30-23)29-21-12-16(26)4-6-18(21)15-2-3-15/h4-7,12-15H,2-3,8-11,26H2,1H3,(H2,27,28,29,30) |
| InChIKey | NCILRTIAWZHXIL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|