C22H30ClIN6O2 — CID 166976294
5-chloro-2-N-[4-(4-iodopiperazin-1-yl)-2-methoxyphenyl]-4-N-[(1R)-1-(oxan-4-yl)ethyl]pyrimidine-2,4-diamine (PubChem CID 166976294) has the molecular formula C22H30ClIN6O2 and a molecular weight of 572.88 g/mol. Its IUPAC name is 5-chloro-2-N-[4-(4-iodopiperazin-1-yl)-2-methoxyphenyl]-4-N-[(1R)-1-(oxan-4-yl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[4-(4-iodopiperazin-1-yl)-2-methoxyphenyl]-4-N-[(1R)-1-(oxan-4-yl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166976294 |
| Molecular Formula | C22H30ClIN6O2 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 5-chloro-2-N-[4-(4-iodopiperazin-1-yl)-2-methoxyphenyl]-4-N-[(1R)-1-(oxan-4-yl)ethyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(N2CCN(I)CC2)ccc1Nc1ncc(Cl)c(N[C@H](C)C2CCOCC2)n1 |
| InChI | InChI=1S/C22H30ClIN6O2/c1-15(16-5-11-32-12-6-16)26-21-18(23)14-25-22(28-21)27-19-4-3-17(13-20(19)31-2)29-7-9-30(24)10-8-29/h3-4,13-16H,5-12H2,1-2H3,(H2,25,26,27,28)/t15-/m1/s1 |
| InChIKey | VJHGXFIZXUJSRO-OAHLLOKOSA-N |
| XLogP | 4.58 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|