C28H34ClIN6O2 — CID 162732555
5-chloro-2-N-[4-(4-iodopiperazin-1-yl)-2-methoxyphenyl]-4-N-(oxolan-2-ylmethyl)-4-N-(2-phenylethyl)pyrimidine-2,4-diamine (PubChem CID 162732555) has the molecular formula C28H34ClIN6O2 and a molecular weight of 648.98 g/mol. Its IUPAC name is 5-chloro-2-N-[4-(4-iodopiperazin-1-yl)-2-methoxyphenyl]-4-N-(oxolan-2-ylmethyl)-4-N-(2-phenylethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[4-(4-iodopiperazin-1-yl)-2-methoxyphenyl]-4-N-(oxolan-2-ylmethyl)-4-N-(2-phenylethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 162732555 |
| Molecular Formula | C28H34ClIN6O2 |
| Molecular Weight | 648.98 g/mol |
| Exact Mass | 648.15 |
| IUPAC Name | 5-chloro-2-N-[4-(4-iodopiperazin-1-yl)-2-methoxyphenyl]-4-N-(oxolan-2-ylmethyl)-4-N-(2-phenylethyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(N2CCN(I)CC2)ccc1Nc1ncc(Cl)c(N(CCc2ccccc2)CC2CCCO2)n1 |
| InChI | InChI=1S/C28H34ClIN6O2/c1-37-26-18-22(34-13-15-36(30)16-14-34)9-10-25(26)32-28-31-19-24(29)27(33-28)35(20-23-8-5-17-38-23)12-11-21-6-3-2-4-7-21/h2-4,6-7,9-10,18-19,23H,5,8,11-17,20H2,1H3,(H,31,32,33) |
| InChIKey | SBDLNLYPZKEOSO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 65.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.98 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|