C20H28ClN5O — CID 118297599
N-[4-(4-tert-butylpiperazin-1-yl)-2-methoxyphenyl]-5-chloro-4-methylpyrimidin-2-amine (PubChem CID 118297599) has the molecular formula C20H28ClN5O and a molecular weight of 389.93 g/mol. Its IUPAC name is N-[4-(4-tert-butylpiperazin-1-yl)-2-methoxyphenyl]-5-chloro-4-methylpyrimidin-2-amine.
| Compound Name | N-[4-(4-tert-butylpiperazin-1-yl)-2-methoxyphenyl]-5-chloro-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 118297599 |
| Molecular Formula | C20H28ClN5O |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-[4-(4-tert-butylpiperazin-1-yl)-2-methoxyphenyl]-5-chloro-4-methylpyrimidin-2-amine |
| SMILES | COc1cc(N2CCN(C(C)(C)C)CC2)ccc1Nc1ncc(Cl)c(C)n1 |
| InChI | InChI=1S/C20H28ClN5O/c1-14-16(21)13-22-19(23-14)24-17-7-6-15(12-18(17)27-5)25-8-10-26(11-9-25)20(2,3)4/h6-7,12-13H,8-11H2,1-5H3,(H,22,23,24) |
| InChIKey | AKWIBOFBPQWCBN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |