C32H43ClN6O5 — CID 158286939
5-chloro-N-(2-methoxy-4-morpholin-4-ylphenyl)-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-amine;2-methoxy-4-morpholin-4-ylaniline (PubChem CID 158286939) has the molecular formula C32H43ClN6O5 and a molecular weight of 627.19 g/mol. Its IUPAC name is 5-chloro-N-(2-methoxy-4-morpholin-4-ylphenyl)-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-amine;2-methoxy-4-morpholin-4-ylaniline.
| Compound Name | 5-chloro-N-(2-methoxy-4-morpholin-4-ylphenyl)-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-amine;2-methoxy-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 158286939 |
| Molecular Formula | C32H43ClN6O5 |
| Molecular Weight | 627.19 g/mol |
| Exact Mass | 626.30 |
| IUPAC Name | 5-chloro-N-(2-methoxy-4-morpholin-4-ylphenyl)-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-amine;2-methoxy-4-morpholin-4-ylaniline |
| SMILES | COc1cc(N2CCOCC2)ccc1N.COc1cc(N2CCOCC2)ccc1Nc1ncc(Cl)c(CCC2CCCO2)n1 |
| InChI | InChI=1S/C21H27ClN4O3.C11H16N2O2/c1-27-20-13-15(26-8-11-28-12-9-26)4-6-19(20)25-21-23-14-17(22)18(24-21)7-5-16-3-2-10-29-16;1-14-11-8-9(2-3-10(11)12)13-4-6-15-7-5-13/h4,6,13-14,16H,2-3,5,7-12H2,1H3,(H,23,24,25);2-3,8H,4-7,12H2,1H3 |
| InChIKey | GKWVWMOQBCSRGL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.19 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|