C25H30ClN5O — CID 147825939
4-[(4-chloro-3-methoxyphenyl)methyl]-5-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 147825939) has the molecular formula C25H30ClN5O and a molecular weight of 452.00 g/mol. Its IUPAC name is 4-[(4-chloro-3-methoxyphenyl)methyl]-5-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[(4-chloro-3-methoxyphenyl)methyl]-5-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 147825939 |
| Molecular Formula | C25H30ClN5O |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 4-[(4-chloro-3-methoxyphenyl)methyl]-5-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CCc1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Cc1ccc(Cl)c(OC)c1 |
| InChI | InChI=1S/C25H30ClN5O/c1-4-19-17-27-25(29-23(19)15-18-5-10-22(26)24(16-18)32-3)28-20-6-8-21(9-7-20)31-13-11-30(2)12-14-31/h5-10,16-17H,4,11-15H2,1-3H3,(H,27,28,29) |
| InChIKey | HQDOVIBAXDBUHP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|