C27H35ClN6O2 — CID 123156557
5-[2-[2-chloro-3-methoxy-5-[(methoxyamino)methyl]phenyl]ethyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 123156557) has the molecular formula C27H35ClN6O2 and a molecular weight of 511.07 g/mol. Its IUPAC name is 5-[2-[2-chloro-3-methoxy-5-[(methoxyamino)methyl]phenyl]ethyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 5-[2-[2-chloro-3-methoxy-5-[(methoxyamino)methyl]phenyl]ethyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 123156557 |
| Molecular Formula | C27H35ClN6O2 |
| Molecular Weight | 511.07 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 5-[2-[2-chloro-3-methoxy-5-[(methoxyamino)methyl]phenyl]ethyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CCN1CCN(c2ccc(Nc3ncc(CCc4cc(CNOC)cc(OC)c4Cl)cn3)cc2)CC1 |
| InChI | InChI=1S/C27H35ClN6O2/c1-4-33-11-13-34(14-12-33)24-9-7-23(8-10-24)32-27-29-17-20(18-30-27)5-6-22-15-21(19-31-36-3)16-25(35-2)26(22)28/h7-10,15-18,31H,4-6,11-14,19H2,1-3H3,(H,29,30,32) |
| InChIKey | INGUWJDCPFKGPU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.07 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|