C29H36FN5O3 — CID 161400817
1-[3-[2-[2-[4-(4-ethylpiperazin-1-yl)-3-methoxyanilino]pyrimidin-5-yl]ethyl]-4-fluoro-5-methoxyphenyl]propan-1-one (PubChem CID 161400817) has the molecular formula C29H36FN5O3 and a molecular weight of 521.64 g/mol. Its IUPAC name is 1-[3-[2-[2-[4-(4-ethylpiperazin-1-yl)-3-methoxyanilino]pyrimidin-5-yl]ethyl]-4-fluoro-5-methoxyphenyl]propan-1-one.
| Compound Name | 1-[3-[2-[2-[4-(4-ethylpiperazin-1-yl)-3-methoxyanilino]pyrimidin-5-yl]ethyl]-4-fluoro-5-methoxyphenyl]propan-1-one |
|---|---|
| PubChem CID | 161400817 |
| Molecular Formula | C29H36FN5O3 |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 1-[3-[2-[2-[4-(4-ethylpiperazin-1-yl)-3-methoxyanilino]pyrimidin-5-yl]ethyl]-4-fluoro-5-methoxyphenyl]propan-1-one |
| SMILES | CCC(=O)c1cc(CCc2cnc(Nc3ccc(N4CCN(CC)CC4)c(OC)c3)nc2)c(F)c(OC)c1 |
| InChI | InChI=1S/C29H36FN5O3/c1-5-25(36)22-15-21(28(30)27(16-22)38-4)8-7-20-18-31-29(32-19-20)33-23-9-10-24(26(17-23)37-3)35-13-11-34(6-2)12-14-35/h9-10,15-19H,5-8,11-14H2,1-4H3,(H,31,32,33) |
| InChIKey | VUFFDIYDAWQVJI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|