C28H35FN6O3 — CID 86304475
3-[2-[2-[4-[(3R)-4-ethyl-3-methylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]-4-fluoro-N,5-dimethoxybenzamide (PubChem CID 86304475) has the molecular formula C28H35FN6O3 and a molecular weight of 522.63 g/mol. Its IUPAC name is 3-[2-[2-[4-[(3R)-4-ethyl-3-methylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]-4-fluoro-N,5-dimethoxybenzamide.
| Compound Name | 3-[2-[2-[4-[(3R)-4-ethyl-3-methylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]-4-fluoro-N,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 86304475 |
| Molecular Formula | C28H35FN6O3 |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 3-[2-[2-[4-[(3R)-4-ethyl-3-methylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]-4-fluoro-N,5-dimethoxybenzamide |
| SMILES | CCN1CCN(c2ccc(Nc3ncc(CCc4cc(C(=O)NOC)cc(OC)c4F)cn3)cc2)C[C@H]1C |
| InChI | InChI=1S/C28H35FN6O3/c1-5-34-12-13-35(18-19(34)2)24-10-8-23(9-11-24)32-28-30-16-20(17-31-28)6-7-21-14-22(27(36)33-38-4)15-25(37-3)26(21)29/h8-11,14-17,19H,5-7,12-13,18H2,1-4H3,(H,33,36)(H,30,31,32)/t19-/m1/s1 |
| InChIKey | VBOIPPMBQFUOBK-LJQANCHMSA-N |
| XLogP | 3.97 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|