C28H35FN6O2 — CID 118687857
4-fluoro-3-methoxy-N-methyl-5-[2-[2-[4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]benzamide (PubChem CID 118687857) has the molecular formula C28H35FN6O2 and a molecular weight of 506.63 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-N-methyl-5-[2-[2-[4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]benzamide.
| Compound Name | 4-fluoro-3-methoxy-N-methyl-5-[2-[2-[4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 118687857 |
| Molecular Formula | C28H35FN6O2 |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 4-fluoro-3-methoxy-N-methyl-5-[2-[2-[4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]benzamide |
| SMILES | CNC(=O)c1cc(CCc2cnc(Nc3ccc(N4C[C@@H](C)N(C)[C@@H](C)C4)cc3)nc2)c(F)c(OC)c1 |
| InChI | InChI=1S/C28H35FN6O2/c1-18-16-35(17-19(2)34(18)4)24-10-8-23(9-11-24)33-28-31-14-20(15-32-28)6-7-21-12-22(27(36)30-3)13-25(37-5)26(21)29/h8-15,18-19H,6-7,16-17H2,1-5H3,(H,30,36)(H,31,32,33)/t18-,19+ |
| InChIKey | MKDCOIFCPOXOAA-KDURUIRLSA-N |
| XLogP | 4.04 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|