C27H32ClFN6O2 — CID 85469278
4-chloro-3-[2-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]-2-fluoro-5-methoxy-N-methylbenzamide (PubChem CID 85469278) has the molecular formula C27H32ClFN6O2 and a molecular weight of 527.04 g/mol. Its IUPAC name is 4-chloro-3-[2-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]-2-fluoro-5-methoxy-N-methylbenzamide.
| Compound Name | 4-chloro-3-[2-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]-2-fluoro-5-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 85469278 |
| Molecular Formula | C27H32ClFN6O2 |
| Molecular Weight | 527.04 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 4-chloro-3-[2-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]anilino]pyrimidin-5-yl]ethyl]-2-fluoro-5-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(OC)c(Cl)c(CCc2cnc(Nc3ccc(N4C[C@@H](C)N[C@@H](C)C4)cc3)nc2)c1F |
| InChI | InChI=1S/C27H32ClFN6O2/c1-16-14-35(15-17(2)33-16)20-8-6-19(7-9-20)34-27-31-12-18(13-32-27)5-10-21-24(28)23(37-4)11-22(25(21)29)26(36)30-3/h6-9,11-13,16-17,33H,5,10,14-15H2,1-4H3,(H,30,36)(H,31,32,34)/t16-,17+ |
| InChIKey | ZZJGQJSEOOGFBH-CALCHBBNSA-N |
| XLogP | 4.35 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.04 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|