C28H31ClN6O3 — CID 118687840
4-chloro-3-[2-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-methoxyanilino]pyrimidin-5-yl]ethynyl]-5-methoxy-N-methylbenzamide (PubChem CID 118687840) has the molecular formula C28H31ClN6O3 and a molecular weight of 535.05 g/mol. Its IUPAC name is 4-chloro-3-[2-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-methoxyanilino]pyrimidin-5-yl]ethynyl]-5-methoxy-N-methylbenzamide.
| Compound Name | 4-chloro-3-[2-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-methoxyanilino]pyrimidin-5-yl]ethynyl]-5-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 118687840 |
| Molecular Formula | C28H31ClN6O3 |
| Molecular Weight | 535.05 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 4-chloro-3-[2-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-methoxyanilino]pyrimidin-5-yl]ethynyl]-5-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(C#Cc2cnc(Nc3ccc(N4C[C@@H](C)N[C@@H](C)C4)c(OC)c3)nc2)c(Cl)c(OC)c1 |
| InChI | InChI=1S/C28H31ClN6O3/c1-17-15-35(16-18(2)33-17)23-9-8-22(12-24(23)37-4)34-28-31-13-19(14-32-28)6-7-20-10-21(27(36)30-3)11-25(38-5)26(20)29/h8-14,17-18,33H,15-16H2,1-5H3,(H,30,36)(H,31,32,34)/t17-,18+ |
| InChIKey | JTZNTZVHOMWJTI-HDICACEKSA-N |
| XLogP | 3.84 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.05 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|