C30H34Cl2N6O3 — CID 90166024
5-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethynyl]-N-[3-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 90166024) has the molecular formula C30H34Cl2N6O3 and a molecular weight of 597.55 g/mol. Its IUPAC name is 5-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethynyl]-N-[3-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 5-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethynyl]-N-[3-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 90166024 |
| Molecular Formula | C30H34Cl2N6O3 |
| Molecular Weight | 597.55 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | 5-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethynyl]-N-[3-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | COc1cc(Nc2ncc(C#Cc3c(Cl)c(OC)cc(OC)c3Cl)cn2)ccc1N1CCC(N2CCNCC2)CC1 |
| InChI | InChI=1S/C30H34Cl2N6O3/c1-39-25-16-21(5-7-24(25)38-12-8-22(9-13-38)37-14-10-33-11-15-37)36-30-34-18-20(19-35-30)4-6-23-28(31)26(40-2)17-27(41-3)29(23)32/h5,7,16-19,22,33H,8-15H2,1-3H3,(H,34,35,36) |
| InChIKey | DIMPEJQGJWFEDV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|