C29H38N6O4 — CID 90166299
5-[(3,5-dimethoxyphenyl)methoxy]-N-[3-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 90166299) has the molecular formula C29H38N6O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is 5-[(3,5-dimethoxyphenyl)methoxy]-N-[3-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 5-[(3,5-dimethoxyphenyl)methoxy]-N-[3-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 90166299 |
| Molecular Formula | C29H38N6O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 5-[(3,5-dimethoxyphenyl)methoxy]-N-[3-methoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | COc1cc(COc2cnc(Nc3ccc(N4CCC(N5CCNCC5)CC4)c(OC)c3)nc2)cc(OC)c1 |
| InChI | InChI=1S/C29H38N6O4/c1-36-24-14-21(15-25(17-24)37-2)20-39-26-18-31-29(32-19-26)33-22-4-5-27(28(16-22)38-3)35-10-6-23(7-11-35)34-12-8-30-9-13-34/h4-5,14-19,23,30H,6-13,20H2,1-3H3,(H,31,32,33) |
| InChIKey | VSOPFHFSVRMEEO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|