C30H38F2N6O4 — CID 90166304
5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-[3-ethoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 90166304) has the molecular formula C30H38F2N6O4 and a molecular weight of 584.67 g/mol. Its IUPAC name is 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-[3-ethoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-[3-ethoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 90166304 |
| Molecular Formula | C30H38F2N6O4 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-[3-ethoxy-4-(4-piperazin-1-ylpiperidin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CCOc1cc(Nc2ncc(OCc3c(F)c(OC)cc(OC)c3F)cn2)ccc1N1CCC(N2CCNCC2)CC1 |
| InChI | InChI=1S/C30H38F2N6O4/c1-4-41-25-15-20(5-6-24(25)38-11-7-21(8-12-38)37-13-9-33-10-14-37)36-30-34-17-22(18-35-30)42-19-23-28(31)26(39-2)16-27(40-3)29(23)32/h5-6,15-18,21,33H,4,7-14,19H2,1-3H3,(H,34,35,36) |
| InChIKey | SISUWYGIAJNPSR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|