C27H30F4N6O — CID 86719261
N-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-5-[(2,3,5,6-tetrafluorophenyl)methoxy]pyrimidin-2-amine (PubChem CID 86719261) has the molecular formula C27H30F4N6O and a molecular weight of 530.57 g/mol. Its IUPAC name is N-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-5-[(2,3,5,6-tetrafluorophenyl)methoxy]pyrimidin-2-amine.
| Compound Name | N-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-5-[(2,3,5,6-tetrafluorophenyl)methoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 86719261 |
| Molecular Formula | C27H30F4N6O |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | N-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-5-[(2,3,5,6-tetrafluorophenyl)methoxy]pyrimidin-2-amine |
| SMILES | CN1CCN(C2CCN(c3cccc(Nc4ncc(OCc5c(F)c(F)cc(F)c5F)cn4)c3)CC2)CC1 |
| InChI | InChI=1S/C27H30F4N6O/c1-35-9-11-37(12-10-35)19-5-7-36(8-6-19)20-4-2-3-18(13-20)34-27-32-15-21(16-33-27)38-17-22-25(30)23(28)14-24(29)26(22)31/h2-4,13-16,19H,5-12,17H2,1H3,(H,32,33,34) |
| InChIKey | OOTJMIUWURDHAU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|