C15H20N6 — CID 69059062
2-N-[3-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 69059062) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 2-N-[3-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 69059062 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-N-[3-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CN1CCN(c2cccc(Nc3nccc(N)n3)c2)CC1 |
| InChI | InChI=1S/C15H20N6/c1-20-7-9-21(10-8-20)13-4-2-3-12(11-13)18-15-17-6-5-14(16)19-15/h2-6,11H,7-10H2,1H3,(H3,16,17,18,19) |
| InChIKey | NLSWSUCNOHOQIN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |