C27H33FN6O2 — CID 85468928
3-[2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethyl]-4-fluoro-5-methoxy-N-methylbenzamide (PubChem CID 85468928) has the molecular formula C27H33FN6O2 and a molecular weight of 492.60 g/mol. Its IUPAC name is 3-[2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethyl]-4-fluoro-5-methoxy-N-methylbenzamide.
| Compound Name | 3-[2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethyl]-4-fluoro-5-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 85468928 |
| Molecular Formula | C27H33FN6O2 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 3-[2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethyl]-4-fluoro-5-methoxy-N-methylbenzamide |
| SMILES | CCN1CCN(c2ccc(Nc3ncc(CCc4cc(C(=O)NC)cc(OC)c4F)cn3)cc2)CC1 |
| InChI | InChI=1S/C27H33FN6O2/c1-4-33-11-13-34(14-12-33)23-9-7-22(8-10-23)32-27-30-17-19(18-31-27)5-6-20-15-21(26(35)29-2)16-24(36-3)25(20)28/h7-10,15-18H,4-6,11-14H2,1-3H3,(H,29,35)(H,30,31,32) |
| InChIKey | MBMHPBMVTQXHGU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|