C24H27ClN6O3 — CID 144700466
4-chloro-3-[[2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]amino]pyrimidin-5-yl]oxymethyl]-5-methoxybenzaldehyde (PubChem CID 144700466) has the molecular formula C24H27ClN6O3 and a molecular weight of 482.97 g/mol. Its IUPAC name is 4-chloro-3-[[2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]amino]pyrimidin-5-yl]oxymethyl]-5-methoxybenzaldehyde.
| Compound Name | 4-chloro-3-[[2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]amino]pyrimidin-5-yl]oxymethyl]-5-methoxybenzaldehyde |
|---|---|
| PubChem CID | 144700466 |
| Molecular Formula | C24H27ClN6O3 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 4-chloro-3-[[2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]amino]pyrimidin-5-yl]oxymethyl]-5-methoxybenzaldehyde |
| SMILES | CCN1CCN(c2ccc(Nc3ncc(OCc4cc(C=O)cc(OC)c4Cl)cn3)cn2)CC1 |
| InChI | InChI=1S/C24H27ClN6O3/c1-3-30-6-8-31(9-7-30)22-5-4-19(12-26-22)29-24-27-13-20(14-28-24)34-16-18-10-17(15-32)11-21(33-2)23(18)25/h4-5,10-15H,3,6-9,16H2,1-2H3,(H,27,28,29) |
| InChIKey | SQOFLGQASOYSQA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|