C27H29N5O2 — CID 144699676
4-[2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethyl]-1-benzofuran-6-carbaldehyde (PubChem CID 144699676) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 4-[2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethyl]-1-benzofuran-6-carbaldehyde.
| Compound Name | 4-[2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethyl]-1-benzofuran-6-carbaldehyde |
|---|---|
| PubChem CID | 144699676 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 4-[2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethyl]-1-benzofuran-6-carbaldehyde |
| SMILES | CCN1CCN(c2ccc(Nc3ncc(CCc4cc(C=O)cc5occc45)cn3)cc2)CC1 |
| InChI | InChI=1S/C27H29N5O2/c1-2-31-10-12-32(13-11-31)24-7-5-23(6-8-24)30-27-28-17-20(18-29-27)3-4-22-15-21(19-33)16-26-25(22)9-14-34-26/h5-9,14-19H,2-4,10-13H2,1H3,(H,28,29,30) |
| InChIKey | WNKOXTLBEJZPNW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|