C24H25N5O2 — CID 144699776
3-methoxy-5-[(E)-2-[2-(4-piperazin-1-ylanilino)pyrimidin-5-yl]ethenyl]benzaldehyde (PubChem CID 144699776) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 3-methoxy-5-[(E)-2-[2-(4-piperazin-1-ylanilino)pyrimidin-5-yl]ethenyl]benzaldehyde.
| Compound Name | 3-methoxy-5-[(E)-2-[2-(4-piperazin-1-ylanilino)pyrimidin-5-yl]ethenyl]benzaldehyde |
|---|---|
| PubChem CID | 144699776 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-methoxy-5-[(E)-2-[2-(4-piperazin-1-ylanilino)pyrimidin-5-yl]ethenyl]benzaldehyde |
| SMILES | COc1cc(C=O)cc(/C=C/c2cnc(Nc3ccc(N4CCNCC4)cc3)nc2)c1 |
| InChI | InChI=1S/C24H25N5O2/c1-31-23-13-18(12-20(14-23)17-30)2-3-19-15-26-24(27-16-19)28-21-4-6-22(7-5-21)29-10-8-25-9-11-29/h2-7,12-17,25H,8-11H2,1H3,(H,26,27,28)/b3-2+ |
| InChIKey | WYBCIWMMFXSVDV-NSCUHMNNSA-N |
| XLogP | 3.62 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|