C27H31N5O3 — CID 90419055
methyl 3-[(E)-2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethenyl]-5-methoxybenzoate (PubChem CID 90419055) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is methyl 3-[(E)-2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethenyl]-5-methoxybenzoate.
| Compound Name | methyl 3-[(E)-2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethenyl]-5-methoxybenzoate |
|---|---|
| PubChem CID | 90419055 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | methyl 3-[(E)-2-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-5-yl]ethenyl]-5-methoxybenzoate |
| SMILES | CCN1CCN(c2ccc(Nc3ncc(/C=C/c4cc(OC)cc(C(=O)OC)c4)cn3)cc2)CC1 |
| InChI | InChI=1S/C27H31N5O3/c1-4-31-11-13-32(14-12-31)24-9-7-23(8-10-24)30-27-28-18-21(19-29-27)6-5-20-15-22(26(33)35-3)17-25(16-20)34-2/h5-10,15-19H,4,11-14H2,1-3H3,(H,28,29,30)/b6-5+ |
| InChIKey | ACXYXLFXLSVORO-AATRIKPKSA-N |
| XLogP | 4.33 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|