C26H35N5O4 — CID 144699807
methanamine;methanol;3-methoxy-5-[2-[2-(4-morpholin-4-ylanilino)pyrimidin-5-yl]ethyl]benzaldehyde (PubChem CID 144699807) has the molecular formula C26H35N5O4 and a molecular weight of 481.60 g/mol. Its IUPAC name is methanamine;methanol;3-methoxy-5-[2-[2-(4-morpholin-4-ylanilino)pyrimidin-5-yl]ethyl]benzaldehyde.
| Compound Name | methanamine;methanol;3-methoxy-5-[2-[2-(4-morpholin-4-ylanilino)pyrimidin-5-yl]ethyl]benzaldehyde |
|---|---|
| PubChem CID | 144699807 |
| Molecular Formula | C26H35N5O4 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | methanamine;methanol;3-methoxy-5-[2-[2-(4-morpholin-4-ylanilino)pyrimidin-5-yl]ethyl]benzaldehyde |
| SMILES | CN.CO.COc1cc(C=O)cc(CCc2cnc(Nc3ccc(N4CCOCC4)cc3)nc2)c1 |
| InChI | InChI=1S/C24H26N4O3.CH5N.CH4O/c1-30-23-13-18(12-20(14-23)17-29)2-3-19-15-25-24(26-16-19)27-21-4-6-22(7-5-21)28-8-10-31-11-9-28;2*1-2/h4-7,12-17H,2-3,8-11H2,1H3,(H,25,26,27);2H2,1H3;2H,1H3 |
| InChIKey | WPXLPSXVKYMDKT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|