C26H32ClN5O — CID 147510269
4-[(4-chloro-3-methoxyphenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-propan-2-ylpyrimidin-2-amine (PubChem CID 147510269) has the molecular formula C26H32ClN5O and a molecular weight of 466.03 g/mol. Its IUPAC name is 4-[(4-chloro-3-methoxyphenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-propan-2-ylpyrimidin-2-amine.
| Compound Name | 4-[(4-chloro-3-methoxyphenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-propan-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 147510269 |
| Molecular Formula | C26H32ClN5O |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 4-[(4-chloro-3-methoxyphenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-propan-2-ylpyrimidin-2-amine |
| SMILES | COc1cc(Cc2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc2C(C)C)ccc1Cl |
| InChI | InChI=1S/C26H32ClN5O/c1-18(2)22-17-28-26(30-24(22)15-19-5-10-23(27)25(16-19)33-4)29-20-6-8-21(9-7-20)32-13-11-31(3)12-14-32/h5-10,16-18H,11-15H2,1-4H3,(H,28,29,30) |
| InChIKey | FJDVLLZLXREDCN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|