C22H24ClFN6 — CID 162732602
5-chloro-4-N-[(4-fluorophenyl)methyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 162732602) has the molecular formula C22H24ClFN6 and a molecular weight of 426.93 g/mol. Its IUPAC name is 5-chloro-4-N-[(4-fluorophenyl)methyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-[(4-fluorophenyl)methyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 162732602 |
| Molecular Formula | C22H24ClFN6 |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 5-chloro-4-N-[(4-fluorophenyl)methyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(Cl)c(NCc4ccc(F)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C22H24ClFN6/c1-29-10-12-30(13-11-29)19-8-6-18(7-9-19)27-22-26-15-20(23)21(28-22)25-14-16-2-4-17(24)5-3-16/h2-9,15H,10-14H2,1H3,(H2,25,26,27,28) |
| InChIKey | GYVNJOZYJAEJNJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|