C29H26ClF2N7O — CID 167423362
2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-6-[(2,6-difluorophenyl)methoxy]benzonitrile (PubChem CID 167423362) has the molecular formula C29H26ClF2N7O and a molecular weight of 562.02 g/mol. Its IUPAC name is 2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-6-[(2,6-difluorophenyl)methoxy]benzonitrile.
| Compound Name | 2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-6-[(2,6-difluorophenyl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 167423362 |
| Molecular Formula | C29H26ClF2N7O |
| Molecular Weight | 562.02 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-6-[(2,6-difluorophenyl)methoxy]benzonitrile |
| SMILES | CN1CCN(c2ccc(Nc3ncc(Cl)c(Nc4cccc(OCc5c(F)cccc5F)c4C#N)n3)cc2)CC1 |
| InChI | InChI=1S/C29H26ClF2N7O/c1-38-12-14-39(15-13-38)20-10-8-19(9-11-20)35-29-34-17-23(30)28(37-29)36-26-6-3-7-27(21(26)16-33)40-18-22-24(31)4-2-5-25(22)32/h2-11,17H,12-15,18H2,1H3,(H2,34,35,36,37) |
| InChIKey | QGMWXVLTEXOINQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.02 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|