C24H26F2N6O2S — CID 121301818
5-[2-(2,4-difluorophenyl)sulfonylethenyl]-4-N-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 121301818) has the molecular formula C24H26F2N6O2S and a molecular weight of 500.58 g/mol. Its IUPAC name is 5-[2-(2,4-difluorophenyl)sulfonylethenyl]-4-N-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[2-(2,4-difluorophenyl)sulfonylethenyl]-4-N-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 121301818 |
| Molecular Formula | C24H26F2N6O2S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 5-[2-(2,4-difluorophenyl)sulfonylethenyl]-4-N-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1C=CS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H26F2N6O2S/c1-27-23-17(9-14-35(33,34)22-8-3-18(25)15-21(22)26)16-28-24(30-23)29-19-4-6-20(7-5-19)32-12-10-31(2)11-13-32/h3-9,14-16H,10-13H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | DSJNCNQCEYCVHK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|