C26H33Cl2N7O3 — CID 154947645
(2,6-dichloro-3,5-dimethoxyanilino)-[[6-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-methylamino]methanol (PubChem CID 154947645) has the molecular formula C26H33Cl2N7O3 and a molecular weight of 562.50 g/mol. Its IUPAC name is (2,6-dichloro-3,5-dimethoxyanilino)-[[6-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-methylamino]methanol.
| Compound Name | (2,6-dichloro-3,5-dimethoxyanilino)-[[6-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-methylamino]methanol |
|---|---|
| PubChem CID | 154947645 |
| Molecular Formula | C26H33Cl2N7O3 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | (2,6-dichloro-3,5-dimethoxyanilino)-[[6-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-methylamino]methanol |
| SMILES | CCN1CCN(c2ccc(Nc3cc(N(C)C(O)Nc4c(Cl)c(OC)cc(OC)c4Cl)ncn3)cc2)CC1 |
| InChI | InChI=1S/C26H33Cl2N7O3/c1-5-34-10-12-35(13-11-34)18-8-6-17(7-9-18)31-21-15-22(30-16-29-21)33(2)26(36)32-25-23(27)19(37-3)14-20(38-4)24(25)28/h6-9,14-16,26,32,36H,5,10-13H2,1-4H3,(H,29,30,31) |
| InChIKey | TWEAWCZHBGGGSV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|