C26H28Cl2N7O7P — CID 140667094
3-(2,6-dichloro-3,5-dimethoxyphenyl)-5-[6-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1-oxo-2,7,8-trioxa-3,5-diaza-1λ5-phosphabicyclo[4.1.1]octan-4-one (PubChem CID 140667094) has the molecular formula C26H28Cl2N7O7P and a molecular weight of 652.43 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-5-[6-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1-oxo-2,7,8-trioxa-3,5-diaza-1λ5-phosphabicyclo[4.1.1]octan-4-one.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-5-[6-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1-oxo-2,7,8-trioxa-3,5-diaza-1λ5-phosphabicyclo[4.1.1]octan-4-one |
|---|---|
| PubChem CID | 140667094 |
| Molecular Formula | C26H28Cl2N7O7P |
| Molecular Weight | 652.43 g/mol |
| Exact Mass | 651.12 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-5-[6-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1-oxo-2,7,8-trioxa-3,5-diaza-1λ5-phosphabicyclo[4.1.1]octan-4-one |
| SMILES | CCN1CCN(c2ccc(Nc3cc(N4C(=O)N(c5c(Cl)c(OC)cc(OC)c5Cl)OP5(=O)OC4O5)ncn3)cc2)CC1 |
| InChI | InChI=1S/C26H28Cl2N7O7P/c1-4-32-9-11-33(12-10-32)17-7-5-16(6-8-17)31-20-14-21(30-15-29-20)34-25(36)35(42-43(37)40-26(34)41-43)24-22(27)18(38-2)13-19(39-3)23(24)28/h5-8,13-15,26H,4,9-12H2,1-3H3,(H,29,30,31) |
| InChIKey | JXHWBBHELQGUJJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|