C26H31Cl2N7O3 — CID 172769457
1-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[[4-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-2-yl]methyl]urea (PubChem CID 172769457) has the molecular formula C26H31Cl2N7O3 and a molecular weight of 560.49 g/mol. Its IUPAC name is 1-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[[4-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-2-yl]methyl]urea.
| Compound Name | 1-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[[4-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 172769457 |
| Molecular Formula | C26H31Cl2N7O3 |
| Molecular Weight | 560.49 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 1-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[[4-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-2-yl]methyl]urea |
| SMILES | CCN1CCN(c2ccc(Nc3ccnc(CNC(=O)Nc4c(Cl)c(OC)cc(OC)c4Cl)n3)cc2)CC1 |
| InChI | InChI=1S/C26H31Cl2N7O3/c1-4-34-11-13-35(14-12-34)18-7-5-17(6-8-18)31-21-9-10-29-22(32-21)16-30-26(36)33-25-23(27)19(37-2)15-20(38-3)24(25)28/h5-10,15H,4,11-14,16H2,1-3H3,(H,29,31,32)(H2,30,33,36) |
| InChIKey | MTHYDBZQTHYYQM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|