C26H27Cl2N7O2 — CID 175708215
2-N-(2,6-dichloro-3,5-dimethoxyphenyl)-6-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[2,3-b]pyrazine-2,6-diamine (PubChem CID 175708215) has the molecular formula C26H27Cl2N7O2 and a molecular weight of 540.46 g/mol. Its IUPAC name is 2-N-(2,6-dichloro-3,5-dimethoxyphenyl)-6-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[2,3-b]pyrazine-2,6-diamine.
| Compound Name | 2-N-(2,6-dichloro-3,5-dimethoxyphenyl)-6-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[2,3-b]pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 175708215 |
| Molecular Formula | C26H27Cl2N7O2 |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-N-(2,6-dichloro-3,5-dimethoxyphenyl)-6-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[2,3-b]pyrazine-2,6-diamine |
| SMILES | COc1cc(OC)c(Cl)c(Nc2cnc3nc(Nc4ccc(N5CCN(C)CC5)cc4)ccc3n2)c1Cl |
| InChI | InChI=1S/C26H27Cl2N7O2/c1-34-10-12-35(13-11-34)17-6-4-16(5-7-17)30-21-9-8-18-26(33-21)29-15-22(31-18)32-25-23(27)19(36-2)14-20(37-3)24(25)28/h4-9,14-15H,10-13H2,1-3H3,(H,31,32)(H,29,30,33) |
| InChIKey | QMYBNILMYYYMIH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|