C25H27ClFN5O2 — CID 169085630
5-chloro-N-(2-fluoro-6-methoxyphenyl)-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyridine-4-carboxamide (PubChem CID 169085630) has the molecular formula C25H27ClFN5O2 and a molecular weight of 483.98 g/mol. Its IUPAC name is 5-chloro-N-(2-fluoro-6-methoxyphenyl)-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyridine-4-carboxamide.
| Compound Name | 5-chloro-N-(2-fluoro-6-methoxyphenyl)-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 169085630 |
| Molecular Formula | C25H27ClFN5O2 |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 5-chloro-N-(2-fluoro-6-methoxyphenyl)-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyridine-4-carboxamide |
| SMILES | COc1cccc(F)c1N(C)C(=O)c1cc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1Cl |
| InChI | InChI=1S/C25H27ClFN5O2/c1-30-11-13-32(14-12-30)18-9-7-17(8-10-18)29-23-15-19(20(26)16-28-23)25(33)31(2)24-21(27)5-4-6-22(24)34-3/h4-10,15-16H,11-14H2,1-3H3,(H,28,29) |
| InChIKey | IMTGFOFGSQYGIC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|