C21H25N5O2 — CID 162646712
5,8-dimethoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-6-amine (PubChem CID 162646712) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 5,8-dimethoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-6-amine.
| Compound Name | 5,8-dimethoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-6-amine |
|---|---|
| PubChem CID | 162646712 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 5,8-dimethoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-6-amine |
| SMILES | COc1c(Nc2ccc(N3CCN(C)CC3)cc2)cc(OC)c2ncncc12 |
| InChI | InChI=1S/C21H25N5O2/c1-25-8-10-26(11-9-25)16-6-4-15(5-7-16)24-18-12-19(27-2)20-17(21(18)28-3)13-22-14-23-20/h4-7,12-14,24H,8-11H2,1-3H3 |
| InChIKey | GXWYGOIBSWXWPY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|