C17H18BrN5 — CID 70498427
5-bromo-3-[4-(4-methylpiperazin-1-yl)anilino]pyridine-2-carbonitrile (PubChem CID 70498427) has the molecular formula C17H18BrN5 and a molecular weight of 372.27 g/mol. Its IUPAC name is 5-bromo-3-[4-(4-methylpiperazin-1-yl)anilino]pyridine-2-carbonitrile.
| Compound Name | 5-bromo-3-[4-(4-methylpiperazin-1-yl)anilino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 70498427 |
| Molecular Formula | C17H18BrN5 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 5-bromo-3-[4-(4-methylpiperazin-1-yl)anilino]pyridine-2-carbonitrile |
| SMILES | CN1CCN(c2ccc(Nc3cc(Br)cnc3C#N)cc2)CC1 |
| InChI | InChI=1S/C17H18BrN5/c1-22-6-8-23(9-7-22)15-4-2-14(3-5-15)21-16-10-13(18)12-20-17(16)11-19/h2-5,10,12,21H,6-9H2,1H3 |
| InChIKey | AGQZWRMFQQEXLX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|