C24H27N7O2S — CID 24987521
5-(6,7-dimethoxyquinazolin-4-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-thiazole-2,4-diamine (PubChem CID 24987521) has the molecular formula C24H27N7O2S and a molecular weight of 477.59 g/mol. Its IUPAC name is 5-(6,7-dimethoxyquinazolin-4-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-thiazole-2,4-diamine.
| Compound Name | 5-(6,7-dimethoxyquinazolin-4-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 24987521 |
| Molecular Formula | C24H27N7O2S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 5-(6,7-dimethoxyquinazolin-4-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-thiazole-2,4-diamine |
| SMILES | COc1cc2ncnc(-c3sc(Nc4ccc(N5CCN(C)CC5)cc4)nc3N)c2cc1OC |
| InChI | InChI=1S/C24H27N7O2S/c1-30-8-10-31(11-9-30)16-6-4-15(5-7-16)28-24-29-23(25)22(34-24)21-17-12-19(32-2)20(33-3)13-18(17)26-14-27-21/h4-7,12-14H,8-11,25H2,1-3H3,(H,28,29) |
| InChIKey | WCUIPKZOZCRLFP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|