C24H29ClN6O2S — CID 87678247
4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]-1,3-benzothiazol-2-amine;hydrochloride (PubChem CID 87678247) has the molecular formula C24H29ClN6O2S and a molecular weight of 501.06 g/mol. Its IUPAC name is 4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]-1,3-benzothiazol-2-amine;hydrochloride.
| Compound Name | 4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]-1,3-benzothiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 87678247 |
| Molecular Formula | C24H29ClN6O2S |
| Molecular Weight | 501.06 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]-1,3-benzothiazol-2-amine;hydrochloride |
| SMILES | COc1cc2c(-c3cccc4sc(N)nc34)ncnc2cc1OCCCN1CCN(C)CC1.Cl |
| InChI | InChI=1S/C24H28N6O2S.ClH/c1-29-8-10-30(11-9-29)7-4-12-32-20-14-18-17(13-19(20)31-2)22(27-15-26-18)16-5-3-6-21-23(16)28-24(25)33-21;/h3,5-6,13-15H,4,7-12H2,1-2H3,(H2,25,28);1H |
| InChIKey | WRRBRRMTWAXLBJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.06 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|