C18H27N5O3 — CID 141094981
2-[4-[3-(4-amino-6-methoxyquinazolin-7-yl)oxypropyl]piperazin-1-yl]ethanol (PubChem CID 141094981) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-[4-[3-(4-amino-6-methoxyquinazolin-7-yl)oxypropyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[3-(4-amino-6-methoxyquinazolin-7-yl)oxypropyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 141094981 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 2-[4-[3-(4-amino-6-methoxyquinazolin-7-yl)oxypropyl]piperazin-1-yl]ethanol |
| SMILES | COc1cc2c(N)ncnc2cc1OCCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C18H27N5O3/c1-25-16-11-14-15(20-13-21-18(14)19)12-17(16)26-10-2-3-22-4-6-23(7-5-22)8-9-24/h11-13,24H,2-10H2,1H3,(H2,19,20,21) |
| InChIKey | ATQWRDKNZNUHQM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|