C9H10N4O — CID 142061671
6-methoxyquinazoline-4,7-diamine (PubChem CID 142061671) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 6-methoxyquinazoline-4,7-diamine.
| Compound Name | 6-methoxyquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 142061671 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 6-methoxyquinazoline-4,7-diamine |
| SMILES | COc1cc2c(N)ncnc2cc1N |
| InChI | InChI=1S/C9H10N4O/c1-14-8-2-5-7(3-6(8)10)12-4-13-9(5)11/h2-4H,10H2,1H3,(H2,11,12,13) |
| InChIKey | MJVVJQIAFWTWRV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|