C23H35N5O3 — CID 174731053
1,3-dicyclohexylurea;6,7-dimethoxyquinazolin-4-amine (PubChem CID 174731053) has the molecular formula C23H35N5O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is 1,3-dicyclohexylurea;6,7-dimethoxyquinazolin-4-amine.
| Compound Name | 1,3-dicyclohexylurea;6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 174731053 |
| Molecular Formula | C23H35N5O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 1,3-dicyclohexylurea;6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(N)c2cc1OC.O=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C13H24N2O.C10H11N3O2/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12;1-14-8-3-6-7(4-9(8)15-2)12-5-13-10(6)11/h11-12H,1-10H2,(H2,14,15,16);3-5H,1-2H3,(H2,11,12,13) |
| InChIKey | YLHCIMCCMGYNKZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |