C18H21N5O3S — CID 170764490
6,7-dimethoxyquinazolin-4-amine;(4-methylsulfanylphenyl)urea (PubChem CID 170764490) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is 6,7-dimethoxyquinazolin-4-amine;(4-methylsulfanylphenyl)urea.
| Compound Name | 6,7-dimethoxyquinazolin-4-amine;(4-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 170764490 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 6,7-dimethoxyquinazolin-4-amine;(4-methylsulfanylphenyl)urea |
| SMILES | COc1cc2ncnc(N)c2cc1OC.CSc1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C10H11N3O2.C8H10N2OS/c1-14-8-3-6-7(4-9(8)15-2)12-5-13-10(6)11;1-12-7-4-2-6(3-5-7)10-8(9)11/h3-5H,1-2H3,(H2,11,12,13);2-5H,1H3,(H3,9,10,11) |
| InChIKey | SHJLCMXJDJVNBM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |