C21H22N3O4PS — CID 170764451
6,7-dimethoxyquinazolin-4-amine;(5-methylsulfanylnaphthalen-1-yl)phosphonous acid (PubChem CID 170764451) has the molecular formula C21H22N3O4PS and a molecular weight of 443.47 g/mol. Its IUPAC name is 6,7-dimethoxyquinazolin-4-amine;(5-methylsulfanylnaphthalen-1-yl)phosphonous acid.
| Compound Name | 6,7-dimethoxyquinazolin-4-amine;(5-methylsulfanylnaphthalen-1-yl)phosphonous acid |
|---|---|
| PubChem CID | 170764451 |
| Molecular Formula | C21H22N3O4PS |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 6,7-dimethoxyquinazolin-4-amine;(5-methylsulfanylnaphthalen-1-yl)phosphonous acid |
| SMILES | COc1cc2ncnc(N)c2cc1OC.CSc1cccc2c(P(O)O)cccc12 |
| InChI | InChI=1S/C11H11O2PS.C10H11N3O2/c1-15-11-7-3-4-8-9(11)5-2-6-10(8)14(12)13;1-14-8-3-6-7(4-9(8)15-2)12-5-13-10(6)11/h2-7,12-13H,1H3;3-5H,1-2H3,(H2,11,12,13) |
| InChIKey | NAKUSWIXRGLDLI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|