C17H17N3O3 — CID 127034132
3-[(6,7-dimethoxyquinazolin-4-yl)-methylamino]phenol (PubChem CID 127034132) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-[(6,7-dimethoxyquinazolin-4-yl)-methylamino]phenol.
| Compound Name | 3-[(6,7-dimethoxyquinazolin-4-yl)-methylamino]phenol |
|---|---|
| PubChem CID | 127034132 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[(6,7-dimethoxyquinazolin-4-yl)-methylamino]phenol |
| SMILES | COc1cc2ncnc(N(C)c3cccc(O)c3)c2cc1OC |
| InChI | InChI=1S/C17H17N3O3/c1-20(11-5-4-6-12(21)7-11)17-13-8-15(22-2)16(23-3)9-14(13)18-10-19-17/h4-10,21H,1-3H3 |
| InChIKey | QYNCZDLVMQIFGR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |