C17H15ClN2O3 — CID 142641273
3-[chloro-(6,7-dimethoxyquinolin-4-yl)amino]phenol (PubChem CID 142641273) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is 3-[chloro-(6,7-dimethoxyquinolin-4-yl)amino]phenol.
| Compound Name | 3-[chloro-(6,7-dimethoxyquinolin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 142641273 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 3-[chloro-(6,7-dimethoxyquinolin-4-yl)amino]phenol |
| SMILES | COc1cc2nccc(N(Cl)c3cccc(O)c3)c2cc1OC |
| InChI | InChI=1S/C17H15ClN2O3/c1-22-16-9-13-14(10-17(16)23-2)19-7-6-15(13)20(18)11-4-3-5-12(21)8-11/h3-10,21H,1-2H3 |
| InChIKey | NGJLHKOAJXZRAF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|