C16H15N2O3P — CID 155331458
[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]phosphane (PubChem CID 155331458) has the molecular formula C16H15N2O3P and a molecular weight of 314.28 g/mol. Its IUPAC name is [5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]phosphane.
| Compound Name | [5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]phosphane |
|---|---|
| PubChem CID | 155331458 |
| Molecular Formula | C16H15N2O3P |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | [5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]phosphane |
| SMILES | COc1cc2nccc(Oc3ccc(P)nc3)c2cc1OC |
| InChI | InChI=1S/C16H15N2O3P/c1-19-14-7-11-12(8-15(14)20-2)17-6-5-13(11)21-10-3-4-16(22)18-9-10/h3-9H,22H2,1-2H3 |
| InChIKey | NITBBJMTSRHQAR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|