C9H9N3O2 — CID 135697903
4-amino-6-methoxyquinazolin-7-ol (PubChem CID 135697903) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-amino-6-methoxyquinazolin-7-ol.
| Compound Name | 4-amino-6-methoxyquinazolin-7-ol |
|---|---|
| PubChem CID | 135697903 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 4-amino-6-methoxyquinazolin-7-ol |
| SMILES | COc1cc2c(N)ncnc2cc1O |
| InChI | InChI=1S/C9H9N3O2/c1-14-8-2-5-6(3-7(8)13)11-4-12-9(5)10/h2-4,13H,1H3,(H2,10,11,12) |
| InChIKey | NMNHXOBOXKLYIP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |