C13H18N4O2 — CID 22649202
6-methoxy-7-N-(3-methoxypropyl)quinazoline-4,7-diamine (PubChem CID 22649202) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 6-methoxy-7-N-(3-methoxypropyl)quinazoline-4,7-diamine.
| Compound Name | 6-methoxy-7-N-(3-methoxypropyl)quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 22649202 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 6-methoxy-7-N-(3-methoxypropyl)quinazoline-4,7-diamine |
| SMILES | COCCCNc1cc2ncnc(N)c2cc1OC |
| InChI | InChI=1S/C13H18N4O2/c1-18-5-3-4-15-11-7-10-9(6-12(11)19-2)13(14)17-8-16-10/h6-8,15H,3-5H2,1-2H3,(H2,14,16,17) |
| InChIKey | QYXRTKHSVRNQIJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|