About 4-N-(3-methoxypropyl)quinazoline-4,7-diamine
4-N-(3-methoxypropyl)quinazoline-4,7-diamine (PubChem CID 65337295) has the molecular formula C12H16N4O
and a molecular weight of 232.29 g/mol. Its IUPAC name is 4-N-(3-methoxypropyl)quinazoline-4,7-diamine.
Molecular Properties
| Compound Name | 4-N-(3-methoxypropyl)quinazoline-4,7-diamine |
| PubChem CID | 65337295 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 4-N-(3-methoxypropyl)quinazoline-4,7-diamine |
| SMILES | COCCCNc1ncnc2cc(N)ccc12 |
| InChI | InChI=1S/C12H16N4O/c1-17-6-2-5-14-12-10-4-3-9(13)7-11(10)15-8-16-12/h3-4,7-8H,2,5-6,13H2,1H3,(H,14,15,16) |
| InChIKey | KGCRXFSMCWUAAL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(3-methoxypropyl)quinazoline-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(3-methoxypropyl)quinazoline-4,7-diamine?
The IUPAC name of 4-N-(3-methoxypropyl)quinazoline-4,7-diamine (CID 65337295) is 4-N-(3-methoxypropyl)quinazoline-4,7-diamine.
What is the SMILES notation for 4-N-(3-methoxypropyl)quinazoline-4,7-diamine?
The canonical SMILES for 4-N-(3-methoxypropyl)quinazoline-4,7-diamine is COCCCNc1ncnc2cc(N)ccc12.
What is the InChIKey of 4-N-(3-methoxypropyl)quinazoline-4,7-diamine?
The InChIKey is KGCRXFSMCWUAAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O/c1-17-6-2-5-14-12-10-4-3-9(13)7-11(10)15-8-16-12/h3-4,7-8H,2,5-6,13H2,1H3,(H,14,15,16).
What are the key properties of 4-N-(3-methoxypropyl)quinazoline-4,7-diamine?
4-N-(3-methoxypropyl)quinazoline-4,7-diamine has a molecular weight of 232.29 g/mol, XLogP of 1.66, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(3-methoxypropyl)quinazoline-4,7-diamine is sourced from PubChem (CID 65337295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).